C21H31NO3S — CID 127053516
(3R,4S)-3-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde (PubChem CID 127053516) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is (3R,4S)-3-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde.
| Compound Name | (3R,4S)-3-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 127053516 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (3R,4S)-3-[(2S)-6-methylhept-5-en-2-yl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde |
| SMILES | CC(C)=CCC[C@H](C)[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)CC[C@@H]1C=O |
| InChI | InChI=1S/C21H31NO3S/c1-16(2)6-5-7-18(4)21-14-22(13-12-19(21)15-23)26(24,25)20-10-8-17(3)9-11-20/h6,8-11,15,18-19,21H,5,7,12-14H2,1-4H3/t18-,19+,21+/m0/s1 |
| InChIKey | SBZMLPBAUARJSM-QKNQBKEWSA-N |
| XLogP | 4.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|