C18H25NO3S — CID 127053529
(3R,4S)-3-cyclopentyl-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde (PubChem CID 127053529) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is (3R,4S)-3-cyclopentyl-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde.
| Compound Name | (3R,4S)-3-cyclopentyl-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 127053529 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (3R,4S)-3-cyclopentyl-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H](C=O)[C@@H](C3CCCC3)C2)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-14-6-8-17(9-7-14)23(21,22)19-11-10-16(13-20)18(12-19)15-4-2-3-5-15/h6-9,13,15-16,18H,2-5,10-12H2,1H3/t16-,18-/m1/s1 |
| InChIKey | OOLWOXLQIHKSRZ-SJLPKXTDSA-N |
| XLogP | 3.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|