C24H22F5NO3 — CID 127053941
(3R,4R,5S)-6,6-difluoro-3,5-dimethyl-4-[(E)-2-[5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one (PubChem CID 127053941) has the molecular formula C24H22F5NO3 and a molecular weight of 467.43 g/mol. Its IUPAC name is (3R,4R,5S)-6,6-difluoro-3,5-dimethyl-4-[(E)-2-[5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | (3R,4R,5S)-6,6-difluoro-3,5-dimethyl-4-[(E)-2-[5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 127053941 |
| Molecular Formula | C24H22F5NO3 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (3R,4R,5S)-6,6-difluoro-3,5-dimethyl-4-[(E)-2-[5-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
| SMILES | CC1OC(=O)C2CC(F)(F)[C@@H](C)[C@H](/C=C/c3ccc(-c4ccccc4OC(F)(F)F)cn3)C12 |
| InChI | InChI=1S/C24H22F5NO3/c1-13-17(21-14(2)32-22(31)19(21)11-23(13,25)26)10-9-16-8-7-15(12-30-16)18-5-3-4-6-20(18)33-24(27,28)29/h3-10,12-14,17,19,21H,11H2,1-2H3/b10-9+/t13-,14?,17-,19?,21?/m0/s1 |
| InChIKey | YALUURSAFOELAT-BAWXAVCASA-N |
| XLogP | 6.13 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |