C26H30N4O3 — CID 127054015
(4S)-5,5-dimethyl-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinylidene]cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 127054015) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinylidene]cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5,5-dimethyl-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinylidene]cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 127054015 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (4S)-5,5-dimethyl-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3-pyridinylidene]cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C2CCC(=C3C=C(C4=NCCCN4)C=NC3=O)CC2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H30N4O3/c1-26(2)22(18-7-4-3-5-8-18)30(25(32)33-26)20-11-9-17(10-12-20)21-15-19(16-29-24(21)31)23-27-13-6-14-28-23/h3-5,7-8,15-16,20,22H,6,9-14H2,1-2H3,(H,27,28)/b21-17-/t20?,22-/m0/s1 |
| InChIKey | VDXHCGOYNOXYMY-HTYDESNXSA-N |
| XLogP | 4.13 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|