About N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide
N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide (PubChem CID 127054396) has the molecular formula C15H17F2N3O2
and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide |
| PubChem CID | 127054396 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc(F)ccc1F)C(=O)NCC#N |
| InChI | InChI=1S/C15H17F2N3O2/c1-9(2)7-13(15(22)19-6-5-18)20-14(21)11-8-10(16)3-4-12(11)17/h3-4,8-9,13H,6-7H2,1-2H3,(H,19,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | MEKJTTGVHKVAKF-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide?
The IUPAC name of N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide (CID 127054396) is N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide.
What is the SMILES notation for N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide?
The canonical SMILES for N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide is CC(C)C[C@H](NC(=O)c1cc(F)ccc1F)C(=O)NCC#N.
What is the InChIKey of N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide?
The InChIKey is MEKJTTGVHKVAKF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H17F2N3O2/c1-9(2)7-13(15(22)19-6-5-18)20-14(21)11-8-10(16)3-4-12(11)17/h3-4,8-9,13H,6-7H2,1-2H3,(H,19,22)(H,20,21)/t13-/m0/s1.
What are the key properties of N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide?
N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide has a molecular weight of 309.32 g/mol, XLogP of 1.75, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,5-difluorobenzamide is sourced from PubChem (CID 127054396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).