C15H15F4N3O2 — CID 127054402
N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 127054402) has the molecular formula C15H15F4N3O2 and a molecular weight of 345.30 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 127054402 |
| Molecular Formula | C15H15F4N3O2 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc(F)c(F)c(F)c1F)C(=O)NCC#N |
| InChI | InChI=1S/C15H15F4N3O2/c1-7(2)5-10(15(24)21-4-3-20)22-14(23)8-6-9(16)12(18)13(19)11(8)17/h6-7,10H,4-5H2,1-2H3,(H,21,24)(H,22,23)/t10-/m0/s1 |
| InChIKey | BIXZRGSFKCHUQP-JTQLQIEISA-N |
| XLogP | 2.03 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|