C15H14F5N3O2 — CID 127054403
N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 127054403) has the molecular formula C15H14F5N3O2 and a molecular weight of 363.29 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 127054403 |
| Molecular Formula | C15H14F5N3O2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)NCC#N |
| InChI | InChI=1S/C15H14F5N3O2/c1-6(2)5-7(14(24)22-4-3-21)23-15(25)8-9(16)11(18)13(20)12(19)10(8)17/h6-7H,4-5H2,1-2H3,(H,22,24)(H,23,25)/t7-/m0/s1 |
| InChIKey | FAZOJUHLABZVDE-ZETCQYMHSA-N |
| XLogP | 2.17 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|