C17H26O4 — CID 127054634
(1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-(hydroxymethyl)-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one (PubChem CID 127054634) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-(hydroxymethyl)-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-(hydroxymethyl)-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 127054634 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-(hydroxymethyl)-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one |
| SMILES | C[C@]12CC=C[C@@](C)(CO)[C@@H]1CCC(=O)[C@@H]2CC1OCCO1 |
| InChI | InChI=1S/C17H26O4/c1-16(11-18)6-3-7-17(2)12(10-15-20-8-9-21-15)13(19)4-5-14(16)17/h3,6,12,14-15,18H,4-5,7-11H2,1-2H3/t12-,14-,16-,17+/m0/s1 |
| InChIKey | SUAMFKOIHCCOTL-ZFZWDLNGSA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|