C11H20O2 — CID 12705597
(5S,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane (PubChem CID 12705597) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (5S,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (5S,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 12705597 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (5S,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane |
| SMILES | C[C@H]1CCCOC12OCCC[C@@H]2C |
| InChI | InChI=1S/C11H20O2/c1-9-5-3-7-12-11(9)10(2)6-4-8-13-11/h9-10H,3-8H2,1-2H3/t9-,10-,11?/m0/s1 |
| InChIKey | WLDFWMGHMJLKHK-QRHSGQBVSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |