About cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol
cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol (PubChem CID 12705658) has the molecular formula C9H20O2Si
and a molecular weight of 188.34 g/mol. Its IUPAC name is cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol.
Molecular Properties
| Compound Name | cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol |
| PubChem CID | 12705658 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol |
| SMILES | C[Si](C)(C)[C@]1(O)CCCC[C@H]1O |
| InChI | InChI=1S/C9H20O2Si/c1-12(2,3)9(11)7-5-4-6-8(9)10/h8,10-11H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | JRLPOENERKAGHC-RKDXNWHRSA-N |
| XLogP | 1.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol?
The IUPAC name of cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol (CID 12705658) is cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol.
What is the SMILES notation for cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol?
The canonical SMILES for cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol is C[Si](C)(C)[C@]1(O)CCCC[C@H]1O.
What is the InChIKey of cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol?
The InChIKey is JRLPOENERKAGHC-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H20O2Si/c1-12(2,3)9(11)7-5-4-6-8(9)10/h8,10-11H,4-7H2,1-3H3/t8-,9-/m1/s1.
What are the key properties of cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol?
cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol has a molecular weight of 188.34 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-1-trimethylsilylcyclohexane-1,2-diol is sourced from PubChem (CID 12705658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).