About (Z)-3-chloropent-2-ene
(Z)-3-chloropent-2-ene (PubChem CID 12705708) has the molecular formula C5H9Cl
and a molecular weight of 104.58 g/mol. Its IUPAC name is (Z)-3-chloropent-2-ene.
Molecular Properties
| Compound Name | (Z)-3-chloropent-2-ene |
| PubChem CID | 12705708 |
| Molecular Formula | C5H9Cl |
| Molecular Weight | 104.58 g/mol |
| Exact Mass | 104.04 |
| IUPAC Name | (Z)-3-chloropent-2-ene |
| SMILES | C/C=C(\Cl)CC |
| InChI | InChI=1S/C5H9Cl/c1-3-5(6)4-2/h3H,4H2,1-2H3/b5-3- |
| InChIKey | VSQKJRIDGSFPSI-HYXAFXHYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (Z)-3-chloropent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-chloropent-2-ene?
The IUPAC name of (Z)-3-chloropent-2-ene (CID 12705708) is (Z)-3-chloropent-2-ene.
What is the SMILES notation for (Z)-3-chloropent-2-ene?
The canonical SMILES for (Z)-3-chloropent-2-ene is C/C=C(\Cl)CC.
What is the InChIKey of (Z)-3-chloropent-2-ene?
The InChIKey is VSQKJRIDGSFPSI-HYXAFXHYSA-N. The full InChI is InChI=1S/C5H9Cl/c1-3-5(6)4-2/h3H,4H2,1-2H3/b5-3-.
What are the key properties of (Z)-3-chloropent-2-ene?
(Z)-3-chloropent-2-ene has a molecular weight of 104.58 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-chloropent-2-ene is sourced from PubChem (CID 12705708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).