About methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate
methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 12706004) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| PubChem CID | 12706004 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2C(C#N)N1C |
| InChI | InChI=1S/C13H14N2O2/c1-15-11(13(16)17-2)7-9-5-3-4-6-10(9)12(15)8-14/h3-6,11-12H,7H2,1-2H3 |
| InChIKey | KXDBBFCZCDTPPG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate?
The IUPAC name of methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate (CID 12706004) is methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate.
What is the SMILES notation for methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate?
The canonical SMILES for methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate is COC(=O)C1Cc2ccccc2C(C#N)N1C.
What is the InChIKey of methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate?
The InChIKey is KXDBBFCZCDTPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-15-11(13(16)17-2)7-9-5-3-4-6-10(9)12(15)8-14/h3-6,11-12H,7H2,1-2H3.
What are the key properties of methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate?
methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate has a molecular weight of 230.27 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-cyano-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxylate is sourced from PubChem (CID 12706004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).