C19H23NO4 — CID 12706040
ethyl (1S,5R,7R)-3-ethoxy-7-ethyl-4-oxo-1-phenyl-2-azabicyclo[3.2.0]hept-2-ene-5-carboxylate (PubChem CID 12706040) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl (1S,5R,7R)-3-ethoxy-7-ethyl-4-oxo-1-phenyl-2-azabicyclo[3.2.0]hept-2-ene-5-carboxylate.
| Compound Name | ethyl (1S,5R,7R)-3-ethoxy-7-ethyl-4-oxo-1-phenyl-2-azabicyclo[3.2.0]hept-2-ene-5-carboxylate |
|---|---|
| PubChem CID | 12706040 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethyl (1S,5R,7R)-3-ethoxy-7-ethyl-4-oxo-1-phenyl-2-azabicyclo[3.2.0]hept-2-ene-5-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@@H](CC)[C@@]1(c1ccccc1)N=C(OCC)C2=O |
| InChI | InChI=1S/C19H23NO4/c1-4-13-12-18(17(22)24-6-3)15(21)16(23-5-2)20-19(13,18)14-10-8-7-9-11-14/h7-11,13H,4-6,12H2,1-3H3/t13-,18-,19+/m1/s1 |
| InChIKey | RBJPCEGUGNXZLP-ZNOIYHFQSA-N |
| XLogP | 2.88 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|