About 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate
6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate (PubChem CID 12706208) has the molecular formula C24H18Cl2O5
and a molecular weight of 457.31 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate |
| PubChem CID | 12706208 |
| Molecular Formula | C24H18Cl2O5 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate |
| SMILES | Cc1c(-c2ccccc2)cc(-c2ccc(Cl)cc2)[o+]c1-c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H18ClO.ClHO4/c1-17-22(18-8-4-2-5-9-18)16-23(19-12-14-21(25)15-13-19)26-24(17)20-10-6-3-7-11-20;2-1(3,4)5/h2-16H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | OJUJUWQEJTWZGZ-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate?
The IUPAC name of 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate (CID 12706208) is 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate.
What is the SMILES notation for 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate?
The canonical SMILES for 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate is Cc1c(-c2ccccc2)cc(-c2ccc(Cl)cc2)[o+]c1-c1ccccc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate?
The InChIKey is OJUJUWQEJTWZGZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H18ClO.ClHO4/c1-17-22(18-8-4-2-5-9-18)16-23(19-12-14-21(25)15-13-19)26-24(17)20-10-6-3-7-11-20;2-1(3,4)5/h2-16H,1H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate?
6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate has a molecular weight of 457.31 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-3-methyl-2,4-diphenylpyrylium perchlorate is sourced from PubChem (CID 12706208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).