About 2-methoxy-3-methyl-2,4,6-triphenylpyran
2-methoxy-3-methyl-2,4,6-triphenylpyran (PubChem CID 12706212) has the molecular formula C25H22O2
and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-methoxy-3-methyl-2,4,6-triphenylpyran.
Molecular Properties
| Compound Name | 2-methoxy-3-methyl-2,4,6-triphenylpyran |
| PubChem CID | 12706212 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-methoxy-3-methyl-2,4,6-triphenylpyran |
| SMILES | COC1(c2ccccc2)OC(c2ccccc2)=CC(c2ccccc2)=C1C |
| InChI | InChI=1S/C25H22O2/c1-19-23(20-12-6-3-7-13-20)18-24(21-14-8-4-9-15-21)27-25(19,26-2)22-16-10-5-11-17-22/h3-18H,1-2H3 |
| InChIKey | FPQJTWAXDSJMCM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-3-methyl-2,4,6-triphenylpyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-methyl-2,4,6-triphenylpyran?
The IUPAC name of 2-methoxy-3-methyl-2,4,6-triphenylpyran (CID 12706212) is 2-methoxy-3-methyl-2,4,6-triphenylpyran.
What is the SMILES notation for 2-methoxy-3-methyl-2,4,6-triphenylpyran?
The canonical SMILES for 2-methoxy-3-methyl-2,4,6-triphenylpyran is COC1(c2ccccc2)OC(c2ccccc2)=CC(c2ccccc2)=C1C.
What is the InChIKey of 2-methoxy-3-methyl-2,4,6-triphenylpyran?
The InChIKey is FPQJTWAXDSJMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O2/c1-19-23(20-12-6-3-7-13-20)18-24(21-14-8-4-9-15-21)27-25(19,26-2)22-16-10-5-11-17-22/h3-18H,1-2H3.
What are the key properties of 2-methoxy-3-methyl-2,4,6-triphenylpyran?
2-methoxy-3-methyl-2,4,6-triphenylpyran has a molecular weight of 354.45 g/mol, XLogP of 6.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-methyl-2,4,6-triphenylpyran is sourced from PubChem (CID 12706212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).