About N'-cyanopropanimidamide
N'-cyanopropanimidamide (PubChem CID 12706424) has the molecular formula C4H7N3
and a molecular weight of 97.12 g/mol. Its IUPAC name is N'-cyanopropanimidamide.
Molecular Properties
| Compound Name | N'-cyanopropanimidamide |
| PubChem CID | 12706424 |
| Molecular Formula | C4H7N3 |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.06 |
| IUPAC Name | N'-cyanopropanimidamide |
| SMILES | CC/C(N)=N\C#N |
| InChI | InChI=1S/C4H7N3/c1-2-4(6)7-3-5/h2H2,1H3,(H2,6,7) |
| InChIKey | ULLKIDSUQPSFFI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyanopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyanopropanimidamide?
The IUPAC name of N'-cyanopropanimidamide (CID 12706424) is N'-cyanopropanimidamide.
What is the SMILES notation for N'-cyanopropanimidamide?
The canonical SMILES for N'-cyanopropanimidamide is CC/C(N)=N\C#N.
What is the InChIKey of N'-cyanopropanimidamide?
The InChIKey is ULLKIDSUQPSFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3/c1-2-4(6)7-3-5/h2H2,1H3,(H2,6,7).
What are the key properties of N'-cyanopropanimidamide?
N'-cyanopropanimidamide has a molecular weight of 97.12 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyanopropanimidamide is sourced from PubChem (CID 12706424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).