C15H23NO — CID 12707374
3-methoxy-2,2,4,4-tetramethyl-5-phenylpyrrolidine (PubChem CID 12707374) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 3-methoxy-2,2,4,4-tetramethyl-5-phenylpyrrolidine.
| Compound Name | 3-methoxy-2,2,4,4-tetramethyl-5-phenylpyrrolidine |
|---|---|
| PubChem CID | 12707374 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-methoxy-2,2,4,4-tetramethyl-5-phenylpyrrolidine |
| SMILES | COC1C(C)(C)NC(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C15H23NO/c1-14(2)12(11-9-7-6-8-10-11)16-15(3,4)13(14)17-5/h6-10,12-13,16H,1-5H3 |
| InChIKey | SYIBYKXFYAXUGH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |