C9H5BrF6O — CID 12707843
2-(2-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 12707843) has the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 12707843 |
| Molecular Formula | C9H5BrF6O |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | 2-(2-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccccc1Br)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5BrF6O/c10-6-4-2-1-3-5(6)7(17,8(11,12)13)9(14,15)16/h1-4,17H |
| InChIKey | XXIHOAKCDPPBFG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |