C7F12 — CID 12708034
3,3,4-trifluoro-1,2,4-tris(trifluoromethyl)cyclobutene (PubChem CID 12708034) has the molecular formula C7F12 and a molecular weight of 312.05 g/mol. Its IUPAC name is 3,3,4-trifluoro-1,2,4-tris(trifluoromethyl)cyclobutene.
| Compound Name | 3,3,4-trifluoro-1,2,4-tris(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 12708034 |
| Molecular Formula | C7F12 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 3,3,4-trifluoro-1,2,4-tris(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C7F12/c8-3(7(17,18)19)1(5(11,12)13)2(4(3,9)10)6(14,15)16 |
| InChIKey | NSQFALRFEYQFJL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|