About 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one
1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one (PubChem CID 12708131) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one |
| PubChem CID | 12708131 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone |
| SMILES | CC(=O)C1CC(=NO1)C2=CC=CC=C2 |
| InChI | InChI=1S/C11H11NO2/c1-8(13)11-7-10(12-14-11)9-5-3-2-4-6-9/h2-6,11H,7H2,1H3 |
| InChIKey | PVMHBTFGOMDWET-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 254 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one?
The IUPAC name of 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one (CID 12708131) is 1-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethanone.
What is the SMILES notation for 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one?
The canonical SMILES for 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one is CC(=O)C1CC(=NO1)C2=CC=CC=C2.
What is the InChIKey of 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one?
The InChIKey is PVMHBTFGOMDWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-8(13)11-7-10(12-14-11)9-5-3-2-4-6-9/h2-6,11H,7H2,1H3.
What are the key properties of 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one?
1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one has a molecular weight of 189.21 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-Phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethan-1-one is sourced from PubChem (CID 12708131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).