About methyl 5-morpholin-4-ylpenta-2,4-diynoate
methyl 5-morpholin-4-ylpenta-2,4-diynoate (PubChem CID 12708947) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl 5-morpholin-4-ylpenta-2,4-diynoate.
Molecular Properties
| Compound Name | methyl 5-morpholin-4-ylpenta-2,4-diynoate |
| PubChem CID | 12708947 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methyl 5-morpholin-4-ylpenta-2,4-diynoate |
| SMILES | COC(=O)C#CC#CN1CCOCC1 |
| InChI | InChI=1S/C10H11NO3/c1-13-10(12)4-2-3-5-11-6-8-14-9-7-11/h6-9H2,1H3 |
| InChIKey | ZZDXIQRFXUIQNM-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-morpholin-4-ylpenta-2,4-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-morpholin-4-ylpenta-2,4-diynoate?
The IUPAC name of methyl 5-morpholin-4-ylpenta-2,4-diynoate (CID 12708947) is methyl 5-morpholin-4-ylpenta-2,4-diynoate.
What is the SMILES notation for methyl 5-morpholin-4-ylpenta-2,4-diynoate?
The canonical SMILES for methyl 5-morpholin-4-ylpenta-2,4-diynoate is COC(=O)C#CC#CN1CCOCC1.
What is the InChIKey of methyl 5-morpholin-4-ylpenta-2,4-diynoate?
The InChIKey is ZZDXIQRFXUIQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-13-10(12)4-2-3-5-11-6-8-14-9-7-11/h6-9H2,1H3.
What are the key properties of methyl 5-morpholin-4-ylpenta-2,4-diynoate?
methyl 5-morpholin-4-ylpenta-2,4-diynoate has a molecular weight of 193.20 g/mol, XLogP of -0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-morpholin-4-ylpenta-2,4-diynoate is sourced from PubChem (CID 12708947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).