About 2-cyclohexyloxetane
2-cyclohexyloxetane (PubChem CID 12709676) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-cyclohexyloxetane.
Molecular Properties
| Compound Name | 2-cyclohexyloxetane |
| PubChem CID | 12709676 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2-cyclohexyloxetane |
| SMILES | C1CCC(C2CCO2)CC1 |
| InChI | InChI=1S/C9H16O/c1-2-4-8(5-3-1)9-6-7-10-9/h8-9H,1-7H2 |
| InChIKey | KREDAVDITUSJEV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxetane?
The IUPAC name of 2-cyclohexyloxetane (CID 12709676) is 2-cyclohexyloxetane.
What is the SMILES notation for 2-cyclohexyloxetane?
The canonical SMILES for 2-cyclohexyloxetane is C1CCC(C2CCO2)CC1.
What is the InChIKey of 2-cyclohexyloxetane?
The InChIKey is KREDAVDITUSJEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-2-4-8(5-3-1)9-6-7-10-9/h8-9H,1-7H2.
What are the key properties of 2-cyclohexyloxetane?
2-cyclohexyloxetane has a molecular weight of 140.23 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxetane is sourced from PubChem (CID 12709676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).