C12F24 — CID 12710298
1,1,1,4,4,5,5,6,7,8,8,8-dodecafluoro-2,3,6,7-tetrakis(trifluoromethyl)oct-2-ene (PubChem CID 12710298) has the molecular formula C12F24 and a molecular weight of 600.08 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,6,7,8,8,8-dodecafluoro-2,3,6,7-tetrakis(trifluoromethyl)oct-2-ene.
| Compound Name | 1,1,1,4,4,5,5,6,7,8,8,8-dodecafluoro-2,3,6,7-tetrakis(trifluoromethyl)oct-2-ene |
|---|---|
| PubChem CID | 12710298 |
| Molecular Formula | C12F24 |
| Molecular Weight | 600.08 g/mol |
| Exact Mass | 599.96 |
| IUPAC Name | 1,1,1,4,4,5,5,6,7,8,8,8-dodecafluoro-2,3,6,7-tetrakis(trifluoromethyl)oct-2-ene |
| SMILES | FC(F)(F)C(=C(C(F)(F)F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F24/c13-3(14,1(4(15,16)17)2(5(18,19)20)6(21,22)23)9(26,27)7(24,10(28,29)30)8(25,11(31,32)33)12(34,35)36 |
| InChIKey | OOMCPVKLDQWHAD-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.08 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|