C13H13NO — CID 12710330
1,2,3,4-tetrahydrocarbazole-9-carbaldehyde (PubChem CID 12710330) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrocarbazole-9-carbaldehyde.
| Compound Name | 1,2,3,4-tetrahydrocarbazole-9-carbaldehyde |
|---|---|
| PubChem CID | 12710330 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1,2,3,4-tetrahydrocarbazole-9-carbaldehyde |
| SMILES | O=Cn1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C13H13NO/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1,3,5,7,9H,2,4,6,8H2 |
| InChIKey | UTEHVQDSQSYATJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|