About 2-chloro-3-ethyloxirane
2-chloro-3-ethyloxirane (PubChem CID 12710518) has the molecular formula C4H7ClO
and a molecular weight of 106.55 g/mol. Its IUPAC name is 2-chloro-3-ethyloxirane.
Molecular Properties
| Compound Name | 2-chloro-3-ethyloxirane |
| PubChem CID | 12710518 |
| Molecular Formula | C4H7ClO |
| Molecular Weight | 106.55 g/mol |
| Exact Mass | 106.02 |
| IUPAC Name | 2-chloro-3-ethyloxirane |
| SMILES | CCC1OC1Cl |
| InChI | InChI=1S/C4H7ClO/c1-2-3-4(5)6-3/h3-4H,2H2,1H3 |
| InChIKey | ITMIRWIISVVMAK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-ethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-ethyloxirane?
The IUPAC name of 2-chloro-3-ethyloxirane (CID 12710518) is 2-chloro-3-ethyloxirane.
What is the SMILES notation for 2-chloro-3-ethyloxirane?
The canonical SMILES for 2-chloro-3-ethyloxirane is CCC1OC1Cl.
What is the InChIKey of 2-chloro-3-ethyloxirane?
The InChIKey is ITMIRWIISVVMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO/c1-2-3-4(5)6-3/h3-4H,2H2,1H3.
What are the key properties of 2-chloro-3-ethyloxirane?
2-chloro-3-ethyloxirane has a molecular weight of 106.55 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-ethyloxirane is sourced from PubChem (CID 12710518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).