C22H24O4 — CID 1271068
2,2-dimethyl-5,5-bis[(3-methylphenyl)methyl]-1,3-dioxane-4,6-dione (PubChem CID 1271068) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2,2-dimethyl-5,5-bis[(3-methylphenyl)methyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5,5-bis[(3-methylphenyl)methyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 1271068 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2,2-dimethyl-5,5-bis[(3-methylphenyl)methyl]-1,3-dioxane-4,6-dione |
| SMILES | Cc1cccc(CC2(Cc3cccc(C)c3)C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C22H24O4/c1-15-7-5-9-17(11-15)13-22(14-18-10-6-8-16(2)12-18)19(23)25-21(3,4)26-20(22)24/h5-12H,13-14H2,1-4H3 |
| InChIKey | FKUUHMWYOYEJER-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|