About 2-nitroso-1,3-dihydroisoindole
2-nitroso-1,3-dihydroisoindole (PubChem CID 12710701) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-nitroso-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-nitroso-1,3-dihydroisoindole |
| PubChem CID | 12710701 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-nitroso-1,3-dihydroisoindole |
| SMILES | O=NN1Cc2ccccc2C1 |
| InChI | InChI=1S/C8H8N2O/c11-9-10-5-7-3-1-2-4-8(7)6-10/h1-4H,5-6H2 |
| InChIKey | DDCSCPRXCTVGSD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroso-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroso-1,3-dihydroisoindole?
The IUPAC name of 2-nitroso-1,3-dihydroisoindole (CID 12710701) is 2-nitroso-1,3-dihydroisoindole.
What is the SMILES notation for 2-nitroso-1,3-dihydroisoindole?
The canonical SMILES for 2-nitroso-1,3-dihydroisoindole is O=NN1Cc2ccccc2C1.
What is the InChIKey of 2-nitroso-1,3-dihydroisoindole?
The InChIKey is DDCSCPRXCTVGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-9-10-5-7-3-1-2-4-8(7)6-10/h1-4H,5-6H2.
What are the key properties of 2-nitroso-1,3-dihydroisoindole?
2-nitroso-1,3-dihydroisoindole has a molecular weight of 148.16 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroso-1,3-dihydroisoindole is sourced from PubChem (CID 12710701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).