About 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole
3-phenyl-5-propan-2-yl-1,2,4-oxadiazole (PubChem CID 12710734) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole |
| PubChem CID | 12710734 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C11H12N2O/c1-8(2)11-12-10(13-14-11)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | LJQVRBYODUPFNI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole?
The IUPAC name of 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole (CID 12710734) is 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole.
What is the SMILES notation for 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole?
The canonical SMILES for 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole is CC(C)c1nc(-c2ccccc2)no1.
What is the InChIKey of 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole?
The InChIKey is LJQVRBYODUPFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-8(2)11-12-10(13-14-11)9-6-4-3-5-7-9/h3-8H,1-2H3.
What are the key properties of 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole?
3-phenyl-5-propan-2-yl-1,2,4-oxadiazole has a molecular weight of 188.23 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-5-propan-2-yl-1,2,4-oxadiazole is sourced from PubChem (CID 12710734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).