C18H18O5 — CID 12710906
1,4-diphenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane (PubChem CID 12710906) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1,4-diphenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane.
| Compound Name | 1,4-diphenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane |
|---|---|
| PubChem CID | 12710906 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1,4-diphenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane |
| SMILES | c1ccc(C2OOC3CCCC(c4ccccc4)(OO2)O3)cc1 |
| InChI | InChI=1S/C18H18O5/c1-3-8-14(9-4-1)17-21-20-16-12-7-13-18(19-16,23-22-17)15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2 |
| InChIKey | FUDOVENJQRRAAX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|