C14H12ClN3O4S — CID 1271094
2-(3-chlorophenoxy)-N-[(5-methyl-4-nitrothiophen-2-yl)methylideneamino]acetamide (PubChem CID 1271094) has the molecular formula C14H12ClN3O4S and a molecular weight of 353.79 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[(5-methyl-4-nitrothiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[(5-methyl-4-nitrothiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1271094 |
| Molecular Formula | C14H12ClN3O4S |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[(5-methyl-4-nitrothiophen-2-yl)methylideneamino]acetamide |
| SMILES | Cc1sc(C=NNC(=O)COc2cccc(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12ClN3O4S/c1-9-13(18(20)21)6-12(23-9)7-16-17-14(19)8-22-11-4-2-3-10(15)5-11/h2-7H,8H2,1H3,(H,17,19) |
| InChIKey | ZRMUHSORZSVGJN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|