About 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide
2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide (PubChem CID 127110273) has the molecular formula C18H31NO3
and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide |
| PubChem CID | 127110273 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide |
| SMILES | CCOC(CNC(=O)CC12CC3CC(CC(C3)C1)C2)OCC |
| InChI | InChI=1S/C18H31NO3/c1-3-21-17(22-4-2)12-19-16(20)11-18-8-13-5-14(9-18)7-15(6-13)10-18/h13-15,17H,3-12H2,1-2H3,(H,19,20) |
| InChIKey | LXFFRCPUADVBEJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide?
The IUPAC name of 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide (CID 127110273) is 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide.
What is the SMILES notation for 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide?
The canonical SMILES for 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide is CCOC(CNC(=O)CC12CC3CC(CC(C3)C1)C2)OCC.
What is the InChIKey of 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide?
The InChIKey is LXFFRCPUADVBEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO3/c1-3-21-17(22-4-2)12-19-16(20)11-18-8-13-5-14(9-18)7-15(6-13)10-18/h13-15,17H,3-12H2,1-2H3,(H,19,20).
What are the key properties of 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide?
2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide has a molecular weight of 309.45 g/mol, XLogP of 3.11, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N-(2,2-diethoxyethyl)acetamide is sourced from PubChem (CID 127110273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).