C6H12F4OSi — CID 12711277
trimethyl(2,2,3,3-tetrafluoropropoxy)silane (PubChem CID 12711277) has the molecular formula C6H12F4OSi and a molecular weight of 204.24 g/mol. Its IUPAC name is trimethyl(2,2,3,3-tetrafluoropropoxy)silane.
| Compound Name | trimethyl(2,2,3,3-tetrafluoropropoxy)silane |
|---|---|
| PubChem CID | 12711277 |
| Molecular Formula | C6H12F4OSi |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | trimethyl(2,2,3,3-tetrafluoropropoxy)silane |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H12F4OSi/c1-12(2,3)11-4-6(9,10)5(7)8/h5H,4H2,1-3H3 |
| InChIKey | DJIBXLRAMMDCIF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|