C8H12F8OSi — CID 12711278
trimethyl(2,2,3,3,4,4,5,5-octafluoropentoxy)silane (PubChem CID 12711278) has the molecular formula C8H12F8OSi and a molecular weight of 304.25 g/mol. Its IUPAC name is trimethyl(2,2,3,3,4,4,5,5-octafluoropentoxy)silane.
| Compound Name | trimethyl(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
|---|---|
| PubChem CID | 12711278 |
| Molecular Formula | C8H12F8OSi |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | trimethyl(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H12F8OSi/c1-18(2,3)17-4-6(11,12)8(15,16)7(13,14)5(9)10/h5H,4H2,1-3H3 |
| InChIKey | VXBUSMZHUVQTMK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|