About trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane
trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane (PubChem CID 12711318) has the molecular formula C12H24OSi2
and a molecular weight of 240.49 g/mol. Its IUPAC name is trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane.
Molecular Properties
| Compound Name | trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane |
| PubChem CID | 12711318 |
| Molecular Formula | C12H24OSi2 |
| Molecular Weight | 240.49 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane |
| SMILES | CC(C)=C=C=C(O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi2/c1-11(2)9-10-12(14(3,4)5)13-15(6,7)8/h1-8H3 |
| InChIKey | WJYQTDFMNVAYNG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane?
The IUPAC name of trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane (CID 12711318) is trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane.
What is the SMILES notation for trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane?
The canonical SMILES for trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane is CC(C)=C=C=C(O[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane?
The InChIKey is WJYQTDFMNVAYNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OSi2/c1-11(2)9-10-12(14(3,4)5)13-15(6,7)8/h1-8H3.
What are the key properties of trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane?
trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane has a molecular weight of 240.49 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(4-methyl-1-trimethylsilyloxypenta-1,2,3-trienyl)silane is sourced from PubChem (CID 12711318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).