About 5-methoxy-2,2-dimethyloxolan-3-one
5-methoxy-2,2-dimethyloxolan-3-one (PubChem CID 12711591) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyloxolan-3-one.
Molecular Properties
| Compound Name | 5-methoxy-2,2-dimethyloxolan-3-one |
| PubChem CID | 12711591 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 5-methoxy-2,2-dimethyloxolan-3-one |
| SMILES | COC1CC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C7H12O3/c1-7(2)5(8)4-6(9-3)10-7/h6H,4H2,1-3H3 |
| InChIKey | GZQGFBFORBUQBF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-2,2-dimethyloxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,2-dimethyloxolan-3-one?
The IUPAC name of 5-methoxy-2,2-dimethyloxolan-3-one (CID 12711591) is 5-methoxy-2,2-dimethyloxolan-3-one.
What is the SMILES notation for 5-methoxy-2,2-dimethyloxolan-3-one?
The canonical SMILES for 5-methoxy-2,2-dimethyloxolan-3-one is COC1CC(=O)C(C)(C)O1.
What is the InChIKey of 5-methoxy-2,2-dimethyloxolan-3-one?
The InChIKey is GZQGFBFORBUQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-7(2)5(8)4-6(9-3)10-7/h6H,4H2,1-3H3.
What are the key properties of 5-methoxy-2,2-dimethyloxolan-3-one?
5-methoxy-2,2-dimethyloxolan-3-one has a molecular weight of 144.17 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,2-dimethyloxolan-3-one is sourced from PubChem (CID 12711591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).