About 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride
4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride (PubChem CID 12711818) has the molecular formula C18H21FO3S
and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride |
| PubChem CID | 12711818 |
| Molecular Formula | C18H21FO3S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride |
| SMILES | CC[C@H](c1ccc(O)cc1)[C@@H](CC)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C18H21FO3S/c1-3-17(13-5-9-15(20)10-6-13)18(4-2)14-7-11-16(12-8-14)23(19,21)22/h5-12,17-18,20H,3-4H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | ABWMCWLAIXGABJ-MSOLQXFVSA-N |
| XLogP | 4.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride?
The IUPAC name of 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride (CID 12711818) is 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride.
What is the SMILES notation for 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride?
The canonical SMILES for 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride is CC[C@H](c1ccc(O)cc1)[C@@H](CC)c1ccc(S(=O)(=O)F)cc1.
What is the InChIKey of 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride?
The InChIKey is ABWMCWLAIXGABJ-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H21FO3S/c1-3-17(13-5-9-15(20)10-6-13)18(4-2)14-7-11-16(12-8-14)23(19,21)22/h5-12,17-18,20H,3-4H2,1-2H3/t17-,18+/m1/s1.
What are the key properties of 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride?
4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride has a molecular weight of 336.43 g/mol, XLogP of 4.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonyl fluoride is sourced from PubChem (CID 12711818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).