About N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide
N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide (PubChem CID 12711822) has the molecular formula C18H21N3O3S
and a molecular weight of 359.45 g/mol. Its IUPAC name is N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide |
| PubChem CID | 12711822 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide |
| SMILES | CC[C@H](c1ccc(O)cc1)[C@@H](CC)c1ccc(S(=O)(=O)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C18H21N3O3S/c1-3-17(13-5-9-15(22)10-6-13)18(4-2)14-7-11-16(12-8-14)25(23,24)21-20-19/h5-12,17-18,22H,3-4H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | WSMINSRWJTXWBI-MSOLQXFVSA-N |
| XLogP | 5.08 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide?
The IUPAC name of N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide (CID 12711822) is N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide.
What is the SMILES notation for N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide?
The canonical SMILES for N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide is CC[C@H](c1ccc(O)cc1)[C@@H](CC)c1ccc(S(=O)(=O)N=[N+]=[N-])cc1.
What is the InChIKey of N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide?
The InChIKey is WSMINSRWJTXWBI-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H21N3O3S/c1-3-17(13-5-9-15(22)10-6-13)18(4-2)14-7-11-16(12-8-14)25(23,24)21-20-19/h5-12,17-18,22H,3-4H2,1-2H3/t17-,18+/m1/s1.
What are the key properties of N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide?
N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide has a molecular weight of 359.45 g/mol, XLogP of 5.08, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-diazo-4-[(3R,4S)-4-(4-hydroxyphenyl)hexan-3-yl]benzenesulfonamide is sourced from PubChem (CID 12711822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).