About 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane]
6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] (PubChem CID 12712158) has the molecular formula C11H18
and a molecular weight of 150.27 g/mol. Its IUPAC name is 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane].
Molecular Properties
| Compound Name | 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] |
| PubChem CID | 12712158 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] |
| SMILES | CC1(C)C2CCC3(CC3)C1C2 |
| InChI | InChI=1S/C11H18/c1-10(2)8-3-4-11(5-6-11)9(10)7-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | VZNJQQBCMQRIIO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane]?
The IUPAC name of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] (CID 12712158) is 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane].
What is the SMILES notation for 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane]?
The canonical SMILES for 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] is CC1(C)C2CCC3(CC3)C1C2.
What is the InChIKey of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane]?
The InChIKey is VZNJQQBCMQRIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-10(2)8-3-4-11(5-6-11)9(10)7-8/h8-9H,3-7H2,1-2H3.
What are the key properties of 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane]?
6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] has a molecular weight of 150.27 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,1'-cyclopropane] is sourced from PubChem (CID 12712158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).