About 5,5-dipentylfuran-2-one
5,5-dipentylfuran-2-one (PubChem CID 12712268) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 5,5-dipentylfuran-2-one.
Molecular Properties
| Compound Name | 5,5-dipentylfuran-2-one |
| PubChem CID | 12712268 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 5,5-dipentylfuran-2-one |
| SMILES | CCCCCC1(CCCCC)C=CC(=O)O1 |
| InChI | InChI=1S/C14H24O2/c1-3-5-7-10-14(11-8-6-4-2)12-9-13(15)16-14/h9,12H,3-8,10-11H2,1-2H3 |
| InChIKey | WRVKOEFYZNGWBU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dipentylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dipentylfuran-2-one?
The IUPAC name of 5,5-dipentylfuran-2-one (CID 12712268) is 5,5-dipentylfuran-2-one.
What is the SMILES notation for 5,5-dipentylfuran-2-one?
The canonical SMILES for 5,5-dipentylfuran-2-one is CCCCCC1(CCCCC)C=CC(=O)O1.
What is the InChIKey of 5,5-dipentylfuran-2-one?
The InChIKey is WRVKOEFYZNGWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-3-5-7-10-14(11-8-6-4-2)12-9-13(15)16-14/h9,12H,3-8,10-11H2,1-2H3.
What are the key properties of 5,5-dipentylfuran-2-one?
5,5-dipentylfuran-2-one has a molecular weight of 224.34 g/mol, XLogP of 4.00, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dipentylfuran-2-one is sourced from PubChem (CID 12712268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).