About 3-bromo-2-methylpentane
3-bromo-2-methylpentane (PubChem CID 12712366) has the molecular formula C6H13Br
and a molecular weight of 165.07 g/mol. Its IUPAC name is 3-bromo-2-methylpentane.
Molecular Properties
| Compound Name | 3-bromo-2-methylpentane |
| PubChem CID | 12712366 |
| Molecular Formula | C6H13Br |
| Molecular Weight | 165.07 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 3-bromo-2-methylpentane |
| SMILES | CCC(Br)C(C)C |
| InChI | InChI=1S/C6H13Br/c1-4-6(7)5(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | MPRUWKDQTYKEDP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.07 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methylpentane?
The IUPAC name of 3-bromo-2-methylpentane (CID 12712366) is 3-bromo-2-methylpentane.
What is the SMILES notation for 3-bromo-2-methylpentane?
The canonical SMILES for 3-bromo-2-methylpentane is CCC(Br)C(C)C.
What is the InChIKey of 3-bromo-2-methylpentane?
The InChIKey is MPRUWKDQTYKEDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13Br/c1-4-6(7)5(2)3/h5-6H,4H2,1-3H3.
What are the key properties of 3-bromo-2-methylpentane?
3-bromo-2-methylpentane has a molecular weight of 165.07 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methylpentane is sourced from PubChem (CID 12712366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).