C11H19NO — CID 127126191
(E)-4,4-dimethyl-1-pyrrolidin-1-ylpent-2-en-1-one (PubChem CID 127126191) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (E)-4,4-dimethyl-1-pyrrolidin-1-ylpent-2-en-1-one.
| Compound Name | (E)-4,4-dimethyl-1-pyrrolidin-1-ylpent-2-en-1-one |
|---|---|
| PubChem CID | 127126191 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (E)-4,4-dimethyl-1-pyrrolidin-1-ylpent-2-en-1-one |
| SMILES | CC(C)(C)/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C11H19NO/c1-11(2,3)7-6-10(13)12-8-4-5-9-12/h6-7H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | LXZYYECALSBVRD-VOTSOKGWSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|