C19H21NO4 — CID 12712729
ethyl (4aS,13bR)-5,6-dioxo-1,2,3,4,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate (PubChem CID 12712729) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl (4aS,13bR)-5,6-dioxo-1,2,3,4,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate.
| Compound Name | ethyl (4aS,13bR)-5,6-dioxo-1,2,3,4,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 12712729 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | ethyl (4aS,13bR)-5,6-dioxo-1,2,3,4,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCC[C@@]13c1ccccc1CCN3C(=O)C2=O |
| InChI | InChI=1S/C19H21NO4/c1-2-24-17(23)18-10-5-6-11-19(18)14-8-4-3-7-13(14)9-12-20(19)16(22)15(18)21/h3-4,7-8H,2,5-6,9-12H2,1H3/t18-,19+/m0/s1 |
| InChIKey | YHHKQGJSENJGJP-RBUKOAKNSA-N |
| XLogP | 1.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|