C10H20N4 — CID 12712894
3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane (PubChem CID 12712894) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane.
| Compound Name | 3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane |
|---|---|
| PubChem CID | 12712894 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane |
| SMILES | C1CNC2C3NCCCN3CCN2C1 |
| InChI | InChI=1S/C10H20N4/c1-3-11-9-10-12-4-2-6-14(10)8-7-13(9)5-1/h9-12H,1-8H2 |
| InChIKey | UFIHNLZICKCIRN-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |