About (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide
(E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 127130490) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide |
| PubChem CID | 127130490 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/C1CC1)NC1=NCCS1 |
| InChI | InChI=1S/C9H12N2OS/c12-8(4-3-7-1-2-7)11-9-10-5-6-13-9/h3-4,7H,1-2,5-6H2,(H,10,11,12)/b4-3+ |
| InChIKey | ZHQJUAXZRWZHHC-ONEGZZNKSA-N |
| XLogP | 1.17 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide?
The IUPAC name of (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide (CID 127130490) is (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide.
What is the SMILES notation for (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide?
The canonical SMILES for (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide is O=C(/C=C/C1CC1)NC1=NCCS1.
What is the InChIKey of (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide?
The InChIKey is ZHQJUAXZRWZHHC-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H12N2OS/c12-8(4-3-7-1-2-7)11-9-10-5-6-13-9/h3-4,7H,1-2,5-6H2,(H,10,11,12)/b4-3+.
What are the key properties of (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide?
(E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide has a molecular weight of 196.27 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-cyclopropyl-N-(4,5-dihydro-1,3-thiazol-2-yl)prop-2-enamide is sourced from PubChem (CID 127130490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).