About 3-(benzylamino)phenol
3-(benzylamino)phenol (PubChem CID 12713133) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(benzylamino)phenol.
Molecular Properties
| Compound Name | 3-(benzylamino)phenol |
| PubChem CID | 12713133 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-(benzylamino)phenol |
| SMILES | Oc1cccc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C13H13NO/c15-13-8-4-7-12(9-13)14-10-11-5-2-1-3-6-11/h1-9,14-15H,10H2 |
| InChIKey | FJOQLJFFNTWVOV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(benzylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)phenol?
The IUPAC name of 3-(benzylamino)phenol (CID 12713133) is 3-(benzylamino)phenol.
What is the SMILES notation for 3-(benzylamino)phenol?
The canonical SMILES for 3-(benzylamino)phenol is Oc1cccc(NCc2ccccc2)c1.
What is the InChIKey of 3-(benzylamino)phenol?
The InChIKey is FJOQLJFFNTWVOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c15-13-8-4-7-12(9-13)14-10-11-5-2-1-3-6-11/h1-9,14-15H,10H2.
What are the key properties of 3-(benzylamino)phenol?
3-(benzylamino)phenol has a molecular weight of 199.25 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)phenol is sourced from PubChem (CID 12713133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).