About platinum(2+);bis(pyridine-2-thiolate)
platinum(2+);bis(pyridine-2-thiolate) (PubChem CID 12713197) has the molecular formula C10H8N2PtS2
and a molecular weight of 415.40 g/mol. Its IUPAC name is platinum(2+);bis(pyridine-2-thiolate).
Molecular Properties
| Compound Name | platinum(2+);bis(pyridine-2-thiolate) |
| PubChem CID | 12713197 |
| Molecular Formula | C10H8N2PtS2 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | platinum(2+);bis(pyridine-2-thiolate) |
| SMILES | [Pt+2].[S-]c1ccccn1.[S-]c1ccccn1 |
| InChI | InChI=1S/2C5H5NS.Pt/c2*7-5-3-1-2-4-6-5;/h2*1-4H,(H,6,7);/q;;+2/p-2 |
| InChIKey | RQUFBNULAWBEHX-UHFFFAOYSA-L |
| XLogP | 1.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze platinum(2+);bis(pyridine-2-thiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum(2+);bis(pyridine-2-thiolate)?
The IUPAC name of platinum(2+);bis(pyridine-2-thiolate) (CID 12713197) is platinum(2+);bis(pyridine-2-thiolate).
What is the SMILES notation for platinum(2+);bis(pyridine-2-thiolate)?
The canonical SMILES for platinum(2+);bis(pyridine-2-thiolate) is [Pt+2].[S-]c1ccccn1.[S-]c1ccccn1.
What is the InChIKey of platinum(2+);bis(pyridine-2-thiolate)?
The InChIKey is RQUFBNULAWBEHX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H5NS.Pt/c2*7-5-3-1-2-4-6-5;/h2*1-4H,(H,6,7);/q;;+2/p-2.
What are the key properties of platinum(2+);bis(pyridine-2-thiolate)?
platinum(2+);bis(pyridine-2-thiolate) has a molecular weight of 415.40 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for platinum(2+);bis(pyridine-2-thiolate) is sourced from PubChem (CID 12713197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).