C10H18N2 — CID 12713370
3,4,6,7,8,9,10,11-octahydro-2H-pyrimido[1,2-a]azocine (PubChem CID 12713370) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 3,4,6,7,8,9,10,11-octahydro-2H-pyrimido[1,2-a]azocine.
| Compound Name | 3,4,6,7,8,9,10,11-octahydro-2H-pyrimido[1,2-a]azocine |
|---|---|
| PubChem CID | 12713370 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3,4,6,7,8,9,10,11-octahydro-2H-pyrimido[1,2-a]azocine |
| SMILES | C1CCCN2CCCN=C2CC1 |
| InChI | InChI=1S/C10H18N2/c1-2-4-8-12-9-5-7-11-10(12)6-3-1/h1-9H2 |
| InChIKey | BIUZELMZLLZWOS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |