C9H5F5S — CID 12713502
1,2,3,4,5-pentafluoro-6-prop-2-enylsulfanylbenzene (PubChem CID 12713502) has the molecular formula C9H5F5S and a molecular weight of 240.20 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-prop-2-enylsulfanylbenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-prop-2-enylsulfanylbenzene |
|---|---|
| PubChem CID | 12713502 |
| Molecular Formula | C9H5F5S |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-prop-2-enylsulfanylbenzene |
| SMILES | C=CCSc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F5S/c1-2-3-15-9-7(13)5(11)4(10)6(12)8(9)14/h2H,1,3H2 |
| InChIKey | NCWGOODZCWQOQA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|