About 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol
1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol (PubChem CID 12713605) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol |
| PubChem CID | 12713605 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol |
| SMILES | OC1(C2=CC=CC2)CCCCC1 |
| InChI | InChI=1S/C11H16O/c12-11(8-4-1-5-9-11)10-6-2-3-7-10/h2-3,6,12H,1,4-5,7-9H2 |
| InChIKey | JPZMSVMTVXQXCF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol?
The IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol (CID 12713605) is 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol is OC1(C2=CC=CC2)CCCCC1.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol?
The InChIKey is JPZMSVMTVXQXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c12-11(8-4-1-5-9-11)10-6-2-3-7-10/h2-3,6,12H,1,4-5,7-9H2.
What are the key properties of 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol?
1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol has a molecular weight of 164.25 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-ylcyclohexan-1-ol is sourced from PubChem (CID 12713605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).