C10H9F13O — CID 12713814
2-butoxy-1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentane (PubChem CID 12713814) has the molecular formula C10H9F13O and a molecular weight of 392.16 g/mol. Its IUPAC name is 2-butoxy-1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentane.
| Compound Name | 2-butoxy-1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 12713814 |
| Molecular Formula | C10H9F13O |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-butoxy-1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentane |
| SMILES | CCCCOC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F13O/c1-2-3-4-24-5(8(15,16)17,9(18,19)20)6(11,12)7(13,14)10(21,22)23/h2-4H2,1H3 |
| InChIKey | OMVLJUKOJZZALL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|